C26H39ClO4 — CID 88801549
(8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11-hydroxy-10,13-dimethyl-17-pentoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88801549) has the molecular formula C26H39ClO4 and a molecular weight of 451.05 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11-hydroxy-10,13-dimethyl-17-pentoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11-hydroxy-10,13-dimethyl-17-pentoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88801549 |
| Molecular Formula | C26H39ClO4 |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11-hydroxy-10,13-dimethyl-17-pentoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCO[C@]1(C(=O)CCl)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C26H39ClO4/c1-4-5-6-13-31-26(22(30)16-27)12-10-20-19-8-7-17-14-18(28)9-11-24(17,2)23(19)21(29)15-25(20,26)3/h14,19-21,23,29H,4-13,15-16H2,1-3H3/t19-,20-,21?,23+,24-,25-,26-/m0/s1 |
| InChIKey | USFBOLZGXPAVLS-TXIYRMRTSA-N |
| XLogP | 5.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|