C21H34O3 — CID 88801553
(3S,5S,8S,9S,10R,13S,14S,17S)-3,17-dimethoxy-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88801553) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (3S,5S,8S,9S,10R,13S,14S,17S)-3,17-dimethoxy-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (3S,5S,8S,9S,10R,13S,14S,17S)-3,17-dimethoxy-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88801553 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (3S,5S,8S,9S,10R,13S,14S,17S)-3,17-dimethoxy-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CO[C@H]1CC[C@@]2(C=O)[C@@H](CC[C@H]3[C@@H]4CC[C@H](OC)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C21H34O3/c1-20-10-9-18-16(17(20)6-7-19(20)24-3)5-4-14-12-15(23-2)8-11-21(14,18)13-22/h13-19H,4-12H2,1-3H3/t14-,15-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | VLBZGNTZFPOVNP-UAMJIQGISA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|