About 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid
1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid (PubChem CID 88801638) has the molecular formula C15H23NO4S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid.
Molecular Properties
| Compound Name | 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid |
| PubChem CID | 88801638 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid |
| SMILES | CC1(C)c2ccccc2OC1N1CCCC1.CS(=O)(=O)O |
| InChI | InChI=1S/C14H19NO.CH4O3S/c1-14(2)11-7-3-4-8-12(11)16-13(14)15-9-5-6-10-15;1-5(2,3)4/h3-4,7-8,13H,5-6,9-10H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | OCGZQMFEDWBPCW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid?
The IUPAC name of 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid (CID 88801638) is 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid.
What is the SMILES notation for 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid?
The canonical SMILES for 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid is CC1(C)c2ccccc2OC1N1CCCC1.CS(=O)(=O)O.
What is the InChIKey of 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid?
The InChIKey is OCGZQMFEDWBPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.CH4O3S/c1-14(2)11-7-3-4-8-12(11)16-13(14)15-9-5-6-10-15;1-5(2,3)4/h3-4,7-8,13H,5-6,9-10H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid?
1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid has a molecular weight of 313.42 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyl-2H-1-benzofuran-2-yl)pyrrolidine;methanesulfonic acid is sourced from PubChem (CID 88801638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).