About azane;aziridin-2-one;4-methylphenol
azane;aziridin-2-one;4-methylphenol (PubChem CID 88801841) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is azane;aziridin-2-one;4-methylphenol.
Molecular Properties
| Compound Name | azane;aziridin-2-one;4-methylphenol |
| PubChem CID | 88801841 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | azane;aziridin-2-one;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.N.O=C1CN1 |
| InChI | InChI=1S/C7H8O.C2H3NO.H3N/c1-6-2-4-7(8)5-3-6;4-2-1-3-2;/h2-5,8H,1H3;1H2,(H,3,4);1H3 |
| InChIKey | RPENPINVAGIENY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;aziridin-2-one;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;aziridin-2-one;4-methylphenol?
The IUPAC name of azane;aziridin-2-one;4-methylphenol (CID 88801841) is azane;aziridin-2-one;4-methylphenol.
What is the SMILES notation for azane;aziridin-2-one;4-methylphenol?
The canonical SMILES for azane;aziridin-2-one;4-methylphenol is Cc1ccc(O)cc1.N.O=C1CN1.
What is the InChIKey of azane;aziridin-2-one;4-methylphenol?
The InChIKey is RPENPINVAGIENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C2H3NO.H3N/c1-6-2-4-7(8)5-3-6;4-2-1-3-2;/h2-5,8H,1H3;1H2,(H,3,4);1H3.
What are the key properties of azane;aziridin-2-one;4-methylphenol?
azane;aziridin-2-one;4-methylphenol has a molecular weight of 182.22 g/mol, XLogP of 0.98, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;aziridin-2-one;4-methylphenol is sourced from PubChem (CID 88801841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).