C9H22N2O2 — CID 88802194
2,2-bis(2-aminopropan-2-yl)propane-1,3-diol (PubChem CID 88802194) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,2-bis(2-aminopropan-2-yl)propane-1,3-diol.
| Compound Name | 2,2-bis(2-aminopropan-2-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 88802194 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2,2-bis(2-aminopropan-2-yl)propane-1,3-diol |
| SMILES | CC(C)(N)C(CO)(CO)C(C)(C)N |
| InChI | InChI=1S/C9H22N2O2/c1-7(2,10)9(5-12,6-13)8(3,4)11/h12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | ULFTXCWZLAEEJF-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |