C16H17NO3 — CID 8880237
2-oxopropyl (E)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enoate (PubChem CID 8880237) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-oxopropyl (E)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enoate.
| Compound Name | 2-oxopropyl (E)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8880237 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-oxopropyl (E)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enoate |
| SMILES | CC(=O)COC(=O)/C(C#N)=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-11(2)14-6-4-13(5-7-14)8-15(9-17)16(19)20-10-12(3)18/h4-8,11H,10H2,1-3H3/b15-8+ |
| InChIKey | MMRIZJPUWIHGJL-OVCLIPMQSA-N |
| XLogP | 2.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|