About tris(2,3-dimethylbut-3-en-2-yl) phosphate
tris(2,3-dimethylbut-3-en-2-yl) phosphate (PubChem CID 88802532) has the molecular formula C18H33O4P
and a molecular weight of 344.43 g/mol. Its IUPAC name is tris(2,3-dimethylbut-3-en-2-yl) phosphate.
Molecular Properties
| Compound Name | tris(2,3-dimethylbut-3-en-2-yl) phosphate |
| PubChem CID | 88802532 |
| Molecular Formula | C18H33O4P |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tris(2,3-dimethylbut-3-en-2-yl) phosphate |
| SMILES | C=C(C)C(C)(C)OP(=O)(OC(C)(C)C(=C)C)OC(C)(C)C(=C)C |
| InChI | InChI=1S/C18H33O4P/c1-13(2)16(7,8)20-23(19,21-17(9,10)14(3)4)22-18(11,12)15(5)6/h1,3,5H2,2,4,6-12H3 |
| InChIKey | BNMVZDFZJMZTBR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(2,3-dimethylbut-3-en-2-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2,3-dimethylbut-3-en-2-yl) phosphate?
The IUPAC name of tris(2,3-dimethylbut-3-en-2-yl) phosphate (CID 88802532) is tris(2,3-dimethylbut-3-en-2-yl) phosphate.
What is the SMILES notation for tris(2,3-dimethylbut-3-en-2-yl) phosphate?
The canonical SMILES for tris(2,3-dimethylbut-3-en-2-yl) phosphate is C=C(C)C(C)(C)OP(=O)(OC(C)(C)C(=C)C)OC(C)(C)C(=C)C.
What is the InChIKey of tris(2,3-dimethylbut-3-en-2-yl) phosphate?
The InChIKey is BNMVZDFZJMZTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33O4P/c1-13(2)16(7,8)20-23(19,21-17(9,10)14(3)4)22-18(11,12)15(5)6/h1,3,5H2,2,4,6-12H3.
What are the key properties of tris(2,3-dimethylbut-3-en-2-yl) phosphate?
tris(2,3-dimethylbut-3-en-2-yl) phosphate has a molecular weight of 344.43 g/mol, XLogP of 6.21, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2,3-dimethylbut-3-en-2-yl) phosphate is sourced from PubChem (CID 88802532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).