C18H14N2Na2O8S2 — CID 88803062
disodium;4-[(5-amino-2-methylbenzoyl)amino]-5-hydroxynaphthalene-2,7-disulfonate (PubChem CID 88803062) has the molecular formula C18H14N2Na2O8S2 and a molecular weight of 496.43 g/mol. Its IUPAC name is disodium;4-[(5-amino-2-methylbenzoyl)amino]-5-hydroxynaphthalene-2,7-disulfonate.
| Compound Name | disodium;4-[(5-amino-2-methylbenzoyl)amino]-5-hydroxynaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 88803062 |
| Molecular Formula | C18H14N2Na2O8S2 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | disodium;4-[(5-amino-2-methylbenzoyl)amino]-5-hydroxynaphthalene-2,7-disulfonate |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])cc(O)c12.[Na+].[Na+] |
| InChI | InChI=1S/C18H16N2O8S2.2Na/c1-9-2-3-11(19)6-14(9)18(22)20-15-7-12(29(23,24)25)4-10-5-13(30(26,27)28)8-16(21)17(10)15;;/h2-8,21H,19H2,1H3,(H,20,22)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
| InChIKey | AZEPBBBCOIJYFO-UHFFFAOYSA-L |
| XLogP | -4.50 |
| TPSA | 189.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|