About 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane
5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane (PubChem CID 88803203) has the molecular formula C17H29NS
and a molecular weight of 279.49 g/mol. Its IUPAC name is 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane.
Molecular Properties
| Compound Name | 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane |
| PubChem CID | 88803203 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane |
| SMILES | CCC1CC(C2CCCCC2)CC(CC)C1N=C=S |
| InChI | InChI=1S/C17H29NS/c1-3-13-10-16(15-8-6-5-7-9-15)11-14(4-2)17(13)18-12-19/h13-17H,3-11H2,1-2H3 |
| InChIKey | YYKXQRGBGMXATO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane?
The IUPAC name of 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane (CID 88803203) is 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane.
What is the SMILES notation for 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane?
The canonical SMILES for 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane is CCC1CC(C2CCCCC2)CC(CC)C1N=C=S.
What is the InChIKey of 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane?
The InChIKey is YYKXQRGBGMXATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NS/c1-3-13-10-16(15-8-6-5-7-9-15)11-14(4-2)17(13)18-12-19/h13-17H,3-11H2,1-2H3.
What are the key properties of 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane?
5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane has a molecular weight of 279.49 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,3-diethyl-2-isothiocyanatocyclohexane is sourced from PubChem (CID 88803203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).