About tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate
tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate (PubChem CID 88803290) has the molecular formula C18H27O4P
and a molecular weight of 338.38 g/mol. Its IUPAC name is tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate.
Molecular Properties
| Compound Name | tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate |
| PubChem CID | 88803290 |
| Molecular Formula | C18H27O4P |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate |
| SMILES | C=C(OP(=O)(OC(=C)/C(C)=C/C)OC(=C)/C(C)=C/C)/C(C)=C/C |
| InChI | InChI=1S/C18H27O4P/c1-10-13(4)16(7)20-23(19,21-17(8)14(5)11-2)22-18(9)15(6)12-3/h10-12H,7-9H2,1-6H3/b13-10+,14-11+,15-12+ |
| InChIKey | WVVKRAAZGRTZKT-DZURWXOBSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate?
The IUPAC name of tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate (CID 88803290) is tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate.
What is the SMILES notation for tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate?
The canonical SMILES for tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate is C=C(OP(=O)(OC(=C)/C(C)=C/C)OC(=C)/C(C)=C/C)/C(C)=C/C.
What is the InChIKey of tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate?
The InChIKey is WVVKRAAZGRTZKT-DZURWXOBSA-N. The full InChI is InChI=1S/C18H27O4P/c1-10-13(4)16(7)20-23(19,21-17(8)14(5)11-2)22-18(9)15(6)12-3/h10-12H,7-9H2,1-6H3/b13-10+,14-11+,15-12+.
What are the key properties of tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate?
tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate has a molecular weight of 338.38 g/mol, XLogP of 6.58, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(3E)-3-methylpenta-1,3-dien-2-yl] phosphate is sourced from PubChem (CID 88803290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).