C10H9NS2 — CID 88803890
5-benzyl-5H-1,3-thiazole-2-thione (PubChem CID 88803890) has the molecular formula C10H9NS2 and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-benzyl-5H-1,3-thiazole-2-thione.
| Compound Name | 5-benzyl-5H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 88803890 |
| Molecular Formula | C10H9NS2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 5-benzyl-5H-1,3-thiazole-2-thione |
| SMILES | S=C1N=CC(Cc2ccccc2)S1 |
| InChI | InChI=1S/C10H9NS2/c12-10-11-7-9(13-10)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2 |
| InChIKey | XOPPDTMDCYLIIB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|