C25H46O6Si — CID 88804008
3-[(2S,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propanal (PubChem CID 88804008) has the molecular formula C25H46O6Si and a molecular weight of 470.72 g/mol. Its IUPAC name is 3-[(2S,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propanal.
| Compound Name | 3-[(2S,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propanal |
|---|---|
| PubChem CID | 88804008 |
| Molecular Formula | C25H46O6Si |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 3-[(2S,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propanal |
| SMILES | CCCCCC(C=C[C@@H]1O[C@@H](OC)C[C@@H](O[Si](C)(C)C)[C@H]1CCC=O)OC1CCCCO1 |
| InChI | InChI=1S/C25H46O6Si/c1-6-7-8-12-20(29-24-14-9-10-18-28-24)15-16-22-21(13-11-17-26)23(31-32(3,4)5)19-25(27-2)30-22/h15-17,20-25H,6-14,18-19H2,1-5H3/t20?,21-,22-,23+,24?,25+/m0/s1 |
| InChIKey | NMSXFHSAXRQASC-DEEAKPAHSA-N |
| XLogP | 5.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|