C15H32N2O3 — CID 88804081
1,3-bis(hexoxymethyl)urea (PubChem CID 88804081) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1,3-bis(hexoxymethyl)urea.
| Compound Name | 1,3-bis(hexoxymethyl)urea |
|---|---|
| PubChem CID | 88804081 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 1,3-bis(hexoxymethyl)urea |
| SMILES | CCCCCCOCNC(=O)NCOCCCCCC |
| InChI | InChI=1S/C15H32N2O3/c1-3-5-7-9-11-19-13-16-15(18)17-14-20-12-10-8-6-4-2/h3-14H2,1-2H3,(H2,16,17,18) |
| InChIKey | RRZRFLUALUMLPP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|