About CID 88804303
CID 88804303 (PubChem CID 88804303) has the molecular formula C64H42MgN8
and a molecular weight of 947.40 g/mol.
Molecular Properties
| Compound Name | CID 88804303 |
| PubChem CID | 88804303 |
| Molecular Formula | C64H42MgN8 |
| Molecular Weight | 947.40 g/mol |
| Exact Mass | 946.34 |
| IUPAC Name | — |
| SMILES | C1=C(c2ccccc2)c2nc1cc1nnc(nc3nc(c(-c4ccccc4)c4c(-c5ccccc5)c(-c5ccccc5)c(c2-c2ccccc2)n4-c2ccccc2)C(c2ccccc2)=N3)n1-c1ccccc1.[Mg] |
| InChI | InChI=1S/C64H42N8.Mg/c1-9-25-43(26-10-1)52-41-49-42-53-69-70-64(71(53)50-37-21-7-22-38-50)68-63-66-58(48-35-19-6-20-36-48)60(67-63)57(47-33-17-5-18-34-47)62-55(45-29-13-3-14-30-45)54(44-27-11-2-12-28-44)61(72(62)51-39-23-8-24-40-51)56(59(52)65-49)46-31-15-4-16-32-46;/h1-42H;/b49-42-,53-42-,59-56-,60-57-,61-56-,62-57-,68-63-,68-64-; |
| InChIKey | OXTXJFFKTJYMQH-PVGUNLNLSA-N |
| XLogP | 14.47 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 947.40 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 88804303 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88804303?
The IUPAC name of CID 88804303 (CID 88804303) is not available.
What is the SMILES notation for CID 88804303?
The canonical SMILES for CID 88804303 is C1=C(c2ccccc2)c2nc1cc1nnc(nc3nc(c(-c4ccccc4)c4c(-c5ccccc5)c(-c5ccccc5)c(c2-c2ccccc2)n4-c2ccccc2)C(c2ccccc2)=N3)n1-c1ccccc1.[Mg].
What is the InChIKey of CID 88804303?
The InChIKey is OXTXJFFKTJYMQH-PVGUNLNLSA-N. The full InChI is InChI=1S/C64H42N8.Mg/c1-9-25-43(26-10-1)52-41-49-42-53-69-70-64(71(53)50-37-21-7-22-38-50)68-63-66-58(48-35-19-6-20-36-48)60(67-63)57(47-33-17-5-18-34-47)62-55(45-29-13-3-14-30-45)54(44-27-11-2-12-28-44)61(72(62)51-39-23-8-24-40-51)56(59(52)65-49)46-31-15-4-16-32-46;/h1-42H;/b49-42-,53-42-,59-56-,60-57-,61-56-,62-57-,68-63-,68-64-;.
What are the key properties of CID 88804303?
CID 88804303 has a molecular weight of 947.40 g/mol, XLogP of 14.47, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88804303 is sourced from PubChem (CID 88804303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).