About 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol
3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol (PubChem CID 88804412) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol.
Molecular Properties
| Compound Name | 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol |
| PubChem CID | 88804412 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol |
| SMILES | C=CCCCCCC(C=C)OC(O)(C=C)CCCCCC=C |
| InChI | InChI=1S/C20H34O2/c1-5-9-11-13-15-17-19(7-3)22-20(21,8-4)18-16-14-12-10-6-2/h5-8,19,21H,1-4,9-18H2 |
| InChIKey | BVBVDQHYLBFQTR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol?
The IUPAC name of 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol (CID 88804412) is 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol.
What is the SMILES notation for 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol?
The canonical SMILES for 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol is C=CCCCCCC(C=C)OC(O)(C=C)CCCCCC=C.
What is the InChIKey of 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol?
The InChIKey is BVBVDQHYLBFQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2/c1-5-9-11-13-15-17-19(7-3)22-20(21,8-4)18-16-14-12-10-6-2/h5-8,19,21H,1-4,9-18H2.
What are the key properties of 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol?
3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol has a molecular weight of 306.49 g/mol, XLogP of 5.71, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deca-1,9-dien-3-yloxydeca-1,9-dien-3-ol is sourced from PubChem (CID 88804412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).