C18H22N6O6S4 — CID 88804711
ethyl 3-amino-2-(1,3-dithiolan-2-ylidene)-3-oxopropanoate;(6S)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88804711) has the molecular formula C18H22N6O6S4 and a molecular weight of 546.68 g/mol. Its IUPAC name is ethyl 3-amino-2-(1,3-dithiolan-2-ylidene)-3-oxopropanoate;(6S)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | ethyl 3-amino-2-(1,3-dithiolan-2-ylidene)-3-oxopropanoate;(6S)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88804711 |
| Molecular Formula | C18H22N6O6S4 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | ethyl 3-amino-2-(1,3-dithiolan-2-ylidene)-3-oxopropanoate;(6S)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCOC(=O)C(C(N)=O)=C1SCCS1.Cn1nnnc1SCC1=C(C(=O)O)N2C(=O)C[C@@H]2SC1 |
| InChI | InChI=1S/C10H11N5O3S2.C8H11NO3S2/c1-14-10(11-12-13-14)20-4-5-3-19-7-2-6(16)15(7)8(5)9(17)18;1-2-12-7(11)5(6(9)10)8-13-3-4-14-8/h7H,2-4H2,1H3,(H,17,18);2-4H2,1H3,(H2,9,10)/t7-;/m0./s1 |
| InChIKey | SWSRSAQNZAWJLR-FJXQXJEOSA-N |
| XLogP | 0.67 |
| TPSA | 170.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|