About sodium;dimethoxy(1-methoxyethoxy)alumane;hydride
sodium;dimethoxy(1-methoxyethoxy)alumane;hydride (PubChem CID 88804741) has the molecular formula C5H14AlNaO4
and a molecular weight of 188.13 g/mol. Its IUPAC name is sodium;dimethoxy(1-methoxyethoxy)alumane;hydride.
Molecular Properties
| Compound Name | sodium;dimethoxy(1-methoxyethoxy)alumane;hydride |
| PubChem CID | 88804741 |
| Molecular Formula | C5H14AlNaO4 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | sodium;dimethoxy(1-methoxyethoxy)alumane;hydride |
| SMILES | COC(C)O[Al](OC)OC.[H-].[Na+] |
| InChI | InChI=1S/C3H7O2.2CH3O.Al.Na.H/c1-3(4)5-2;2*1-2;;;/h3H,1-2H3;2*1H3;;;/q3*-1;+3;+1;-1 |
| InChIKey | RUWBOZZDDKXDSA-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze sodium;dimethoxy(1-methoxyethoxy)alumane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dimethoxy(1-methoxyethoxy)alumane;hydride?
The IUPAC name of sodium;dimethoxy(1-methoxyethoxy)alumane;hydride (CID 88804741) is sodium;dimethoxy(1-methoxyethoxy)alumane;hydride.
What is the SMILES notation for sodium;dimethoxy(1-methoxyethoxy)alumane;hydride?
The canonical SMILES for sodium;dimethoxy(1-methoxyethoxy)alumane;hydride is COC(C)O[Al](OC)OC.[H-].[Na+].
What is the InChIKey of sodium;dimethoxy(1-methoxyethoxy)alumane;hydride?
The InChIKey is RUWBOZZDDKXDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O2.2CH3O.Al.Na.H/c1-3(4)5-2;2*1-2;;;/h3H,1-2H3;2*1H3;;;/q3*-1;+3;+1;-1.
What are the key properties of sodium;dimethoxy(1-methoxyethoxy)alumane;hydride?
sodium;dimethoxy(1-methoxyethoxy)alumane;hydride has a molecular weight of 188.13 g/mol, XLogP of -2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dimethoxy(1-methoxyethoxy)alumane;hydride is sourced from PubChem (CID 88804741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).