About (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate
(3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate (PubChem CID 88804843) has the molecular formula C12H10N2S2
and a molecular weight of 246.36 g/mol. Its IUPAC name is (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate.
Molecular Properties
| Compound Name | (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate |
| PubChem CID | 88804843 |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate |
| SMILES | C#CCCN1c2ccccc2SC1SC#N |
| InChI | InChI=1S/C12H10N2S2/c1-2-3-8-14-10-6-4-5-7-11(10)16-12(14)15-9-13/h1,4-7,12H,3,8H2 |
| InChIKey | SSECAKKYGCGADY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate?
The IUPAC name of (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate (CID 88804843) is (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate.
What is the SMILES notation for (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate?
The canonical SMILES for (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate is C#CCCN1c2ccccc2SC1SC#N.
What is the InChIKey of (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate?
The InChIKey is SSECAKKYGCGADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2S2/c1-2-3-8-14-10-6-4-5-7-11(10)16-12(14)15-9-13/h1,4-7,12H,3,8H2.
What are the key properties of (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate?
(3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate has a molecular weight of 246.36 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-but-3-ynyl-2H-1,3-benzothiazol-2-yl) thiocyanate is sourced from PubChem (CID 88804843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).