About N-chloro-4-diazocyclohexa-1,5-dien-1-amine
N-chloro-4-diazocyclohexa-1,5-dien-1-amine (PubChem CID 88805100) has the molecular formula C6H6ClN3
and a molecular weight of 155.59 g/mol. Its IUPAC name is N-chloro-4-diazocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-chloro-4-diazocyclohexa-1,5-dien-1-amine |
| PubChem CID | 88805100 |
| Molecular Formula | C6H6ClN3 |
| Molecular Weight | 155.59 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | N-chloro-4-diazocyclohexa-1,5-dien-1-amine |
| SMILES | [N-]=[N+]=C1C=CC(NCl)=CC1 |
| InChI | InChI=1S/C6H6ClN3/c7-9-5-1-3-6(10-8)4-2-5/h1-3,9H,4H2 |
| InChIKey | HPNHYAPCHIUELM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-4-diazocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-4-diazocyclohexa-1,5-dien-1-amine?
The IUPAC name of N-chloro-4-diazocyclohexa-1,5-dien-1-amine (CID 88805100) is N-chloro-4-diazocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-chloro-4-diazocyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-chloro-4-diazocyclohexa-1,5-dien-1-amine is [N-]=[N+]=C1C=CC(NCl)=CC1.
What is the InChIKey of N-chloro-4-diazocyclohexa-1,5-dien-1-amine?
The InChIKey is HPNHYAPCHIUELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3/c7-9-5-1-3-6(10-8)4-2-5/h1-3,9H,4H2.
What are the key properties of N-chloro-4-diazocyclohexa-1,5-dien-1-amine?
N-chloro-4-diazocyclohexa-1,5-dien-1-amine has a molecular weight of 155.59 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-4-diazocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 88805100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).