About [diisocyanato(phenyl)methyl]benzene;oxolane
[diisocyanato(phenyl)methyl]benzene;oxolane (PubChem CID 88805260) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is [diisocyanato(phenyl)methyl]benzene;oxolane.
Molecular Properties
| Compound Name | [diisocyanato(phenyl)methyl]benzene;oxolane |
| PubChem CID | 88805260 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [diisocyanato(phenyl)methyl]benzene;oxolane |
| SMILES | C1CCOC1.O=C=NC(N=C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2.C4H8O/c18-11-16-15(17-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-2-4-5-3-1/h1-10H;1-4H2 |
| InChIKey | USITUWLRSADLOH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [diisocyanato(phenyl)methyl]benzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diisocyanato(phenyl)methyl]benzene;oxolane?
The IUPAC name of [diisocyanato(phenyl)methyl]benzene;oxolane (CID 88805260) is [diisocyanato(phenyl)methyl]benzene;oxolane.
What is the SMILES notation for [diisocyanato(phenyl)methyl]benzene;oxolane?
The canonical SMILES for [diisocyanato(phenyl)methyl]benzene;oxolane is C1CCOC1.O=C=NC(N=C=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [diisocyanato(phenyl)methyl]benzene;oxolane?
The InChIKey is USITUWLRSADLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2.C4H8O/c18-11-16-15(17-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-2-4-5-3-1/h1-10H;1-4H2.
What are the key properties of [diisocyanato(phenyl)methyl]benzene;oxolane?
[diisocyanato(phenyl)methyl]benzene;oxolane has a molecular weight of 322.36 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [diisocyanato(phenyl)methyl]benzene;oxolane is sourced from PubChem (CID 88805260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).