C19H39NO5S — CID 88805495
7-[(5-hydroxy-6,6-dimethyldecyl)sulfonylamino]heptanoic acid (PubChem CID 88805495) has the molecular formula C19H39NO5S and a molecular weight of 393.59 g/mol. Its IUPAC name is 7-[(5-hydroxy-6,6-dimethyldecyl)sulfonylamino]heptanoic acid.
| Compound Name | 7-[(5-hydroxy-6,6-dimethyldecyl)sulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 88805495 |
| Molecular Formula | C19H39NO5S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 7-[(5-hydroxy-6,6-dimethyldecyl)sulfonylamino]heptanoic acid |
| SMILES | CCCCC(C)(C)C(O)CCCCS(=O)(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C19H39NO5S/c1-4-5-14-19(2,3)17(21)12-9-11-16-26(24,25)20-15-10-7-6-8-13-18(22)23/h17,20-21H,4-16H2,1-3H3,(H,22,23) |
| InChIKey | ZOJNCKIIKAYYMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|