About O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate
O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate (PubChem CID 88805763) has the molecular formula C16H24N2O2S3
and a molecular weight of 372.58 g/mol. Its IUPAC name is O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate |
| PubChem CID | 88805763 |
| Molecular Formula | C16H24N2O2S3 |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1cc(COC(=S)N(C)C)c(C)c(CSC(=S)N(C)C)c1O |
| InChI | InChI=1S/C16H24N2O2S3/c1-10-7-12(8-20-15(21)17(3)4)11(2)13(14(10)19)9-23-16(22)18(5)6/h7,19H,8-9H2,1-6H3 |
| InChIKey | XALGPUZWPOLHLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate?
The IUPAC name of O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate (CID 88805763) is O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate?
The canonical SMILES for O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate is Cc1cc(COC(=S)N(C)C)c(C)c(CSC(=S)N(C)C)c1O.
What is the InChIKey of O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate?
The InChIKey is XALGPUZWPOLHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2S3/c1-10-7-12(8-20-15(21)17(3)4)11(2)13(14(10)19)9-23-16(22)18(5)6/h7,19H,8-9H2,1-6H3.
What are the key properties of O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate?
O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate has a molecular weight of 372.58 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[3-(dimethylcarbamothioylsulfanylmethyl)-4-hydroxy-2,5-dimethylphenyl]methyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 88805763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).