C15H15NO2 — CID 88805787
N-phenyl-N-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine (PubChem CID 88805787) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-phenyl-N-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine.
| Compound Name | N-phenyl-N-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 88805787 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-phenyl-N-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
| SMILES | CCCON(c1ccccc1)c1cccc2c1O2 |
| InChI | InChI=1S/C15H15NO2/c1-2-11-17-16(12-7-4-3-5-8-12)13-9-6-10-14-15(13)18-14/h3-10H,2,11H2,1H3 |
| InChIKey | XWIPYZICMKJIKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|