About N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine
N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine (PubChem CID 88805800) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine |
| PubChem CID | 88805800 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine |
| SMILES | c1cnc(N/N=C2/CCc3ccccc32)nc1 |
| InChI | InChI=1S/C13H12N4/c1-2-5-11-10(4-1)6-7-12(11)16-17-13-14-8-3-9-15-13/h1-5,8-9H,6-7H2,(H,14,15,17)/b16-12- |
| InChIKey | BQFKVSQTMWDHNP-VBKFSLOCSA-N |
| XLogP | 2.24 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine?
The IUPAC name of N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine (CID 88805800) is N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine.
What is the SMILES notation for N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine?
The canonical SMILES for N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine is c1cnc(N/N=C2/CCc3ccccc32)nc1.
What is the InChIKey of N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine?
The InChIKey is BQFKVSQTMWDHNP-VBKFSLOCSA-N. The full InChI is InChI=1S/C13H12N4/c1-2-5-11-10(4-1)6-7-12(11)16-17-13-14-8-3-9-15-13/h1-5,8-9H,6-7H2,(H,14,15,17)/b16-12-.
What are the key properties of N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine?
N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine has a molecular weight of 224.27 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2,3-dihydroinden-1-ylideneamino]pyrimidin-2-amine is sourced from PubChem (CID 88805800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).