About (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride
(4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride (PubChem CID 88806154) has the molecular formula C15H23ClN2O3S2
and a molecular weight of 378.95 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride.
Molecular Properties
| Compound Name | (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride |
| PubChem CID | 88806154 |
| Molecular Formula | C15H23ClN2O3S2 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride |
| SMILES | COc1cc(CSC(=S)N2CCN(C)CC2)cc(OC)c1O.Cl |
| InChI | InChI=1S/C15H22N2O3S2.ClH/c1-16-4-6-17(7-5-16)15(21)22-10-11-8-12(19-2)14(18)13(9-11)20-3;/h8-9,18H,4-7,10H2,1-3H3;1H |
| InChIKey | LJEFOVDQJGUFSR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride?
The IUPAC name of (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride (CID 88806154) is (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride.
What is the SMILES notation for (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride?
The canonical SMILES for (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride is COc1cc(CSC(=S)N2CCN(C)CC2)cc(OC)c1O.Cl.
What is the InChIKey of (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride?
The InChIKey is LJEFOVDQJGUFSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S2.ClH/c1-16-4-6-17(7-5-16)15(21)22-10-11-8-12(19-2)14(18)13(9-11)20-3;/h8-9,18H,4-7,10H2,1-3H3;1H.
What are the key properties of (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride?
(4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride has a molecular weight of 378.95 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3,5-dimethoxyphenyl)methyl 4-methylpiperazine-1-carbodithioate;hydrochloride is sourced from PubChem (CID 88806154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).