About carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate
carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate (PubChem CID 88806322) has the molecular formula C7H17N3O2S2
and a molecular weight of 239.37 g/mol. Its IUPAC name is carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate |
| PubChem CID | 88806322 |
| Molecular Formula | C7H17N3O2S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate |
| SMILES | CNC(=S)OCCN(C)C.NC(=O)S |
| InChI | InChI=1S/C6H14N2OS.CH3NOS/c1-7-6(10)9-5-4-8(2)3;2-1(3)4/h4-5H2,1-3H3,(H,7,10);(H3,2,3,4) |
| InChIKey | SHNSLUBYBVEBLC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate?
The IUPAC name of carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate (CID 88806322) is carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate?
The canonical SMILES for carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate is CNC(=S)OCCN(C)C.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate?
The InChIKey is SHNSLUBYBVEBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS.CH3NOS/c1-7-6(10)9-5-4-8(2)3;2-1(3)4/h4-5H2,1-3H3,(H,7,10);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate?
carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate has a molecular weight of 239.37 g/mol, XLogP of 0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-[2-(dimethylamino)ethyl] N-methylcarbamothioate is sourced from PubChem (CID 88806322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).