About carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate
carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate (PubChem CID 88806440) has the molecular formula C11H16N2O6S2
and a molecular weight of 336.39 g/mol. Its IUPAC name is carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate |
| PubChem CID | 88806440 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OCc1oc(CO)cc(=O)c1O.NC(=O)S |
| InChI | InChI=1S/C10H13NO5S.CH3NOS/c1-11(2)10(17)15-5-8-9(14)7(13)3-6(4-12)16-8;2-1(3)4/h3,12,14H,4-5H2,1-2H3;(H3,2,3,4) |
| InChIKey | OFXXOEWBJTWIAJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate?
The IUPAC name of carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate (CID 88806440) is carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate?
The canonical SMILES for carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate is CN(C)C(=S)OCc1oc(CO)cc(=O)c1O.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate?
The InChIKey is OFXXOEWBJTWIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5S.CH3NOS/c1-11(2)10(17)15-5-8-9(14)7(13)3-6(4-12)16-8;2-1(3)4/h3,12,14H,4-5H2,1-2H3;(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate?
carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate has a molecular weight of 336.39 g/mol, XLogP of 0.20, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 88806440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).