C17F32 — CID 88806800
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluoro-8-[2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-(trifluoromethyl)cyclooctyl]cyclooctane (PubChem CID 88806800) has the molecular formula C17F32 and a molecular weight of 812.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluoro-8-[2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-(trifluoromethyl)cyclooctyl]cyclooctane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluoro-8-[2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-(trifluoromethyl)cyclooctyl]cyclooctane |
|---|---|
| PubChem CID | 88806800 |
| Molecular Formula | C17F32 |
| Molecular Weight | 812.12 g/mol |
| Exact Mass | 811.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluoro-8-[2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-1-(trifluoromethyl)cyclooctyl]cyclooctane |
| SMILES | FC(F)(F)C1(C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17F32/c18-2(5(23,24)9(31,32)13(39,40)16(45,46)14(41,42)10(33,34)6(2,25)26)1(17(47,48)49)3(19,20)7(27,28)11(35,36)15(43,44)12(37,38)8(29,30)4(1,21)22 |
| InChIKey | RVDFASGLKXQJIC-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.12 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|