About dibromonickel;bis(tris(4-methylphenyl)phosphanium)
dibromonickel;bis(tris(4-methylphenyl)phosphanium) (PubChem CID 88807192) has the molecular formula C42H44Br2NiP2+2
and a molecular weight of 829.26 g/mol. Its IUPAC name is dibromonickel;bis(tris(4-methylphenyl)phosphanium).
Molecular Properties
| Compound Name | dibromonickel;bis(tris(4-methylphenyl)phosphanium) |
| PubChem CID | 88807192 |
| Molecular Formula | C42H44Br2NiP2+2 |
| Molecular Weight | 829.26 g/mol |
| Exact Mass | 826.06 |
| IUPAC Name | dibromonickel;bis(tris(4-methylphenyl)phosphanium) |
| SMILES | Br[Ni]Br.Cc1ccc([PH+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.Cc1ccc([PH+](c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/2C21H21P.2BrH.Ni/c2*1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;;/h2*4-15H,1-3H3;2*1H;/q;;;;+2 |
| InChIKey | VGMKWZZESCIGIU-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 829.26 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromonickel;bis(tris(4-methylphenyl)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromonickel;bis(tris(4-methylphenyl)phosphanium)?
The IUPAC name of dibromonickel;bis(tris(4-methylphenyl)phosphanium) (CID 88807192) is dibromonickel;bis(tris(4-methylphenyl)phosphanium).
What is the SMILES notation for dibromonickel;bis(tris(4-methylphenyl)phosphanium)?
The canonical SMILES for dibromonickel;bis(tris(4-methylphenyl)phosphanium) is Br[Ni]Br.Cc1ccc([PH+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.Cc1ccc([PH+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of dibromonickel;bis(tris(4-methylphenyl)phosphanium)?
The InChIKey is VGMKWZZESCIGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H21P.2BrH.Ni/c2*1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;;/h2*4-15H,1-3H3;2*1H;/q;;;;+2.
What are the key properties of dibromonickel;bis(tris(4-methylphenyl)phosphanium)?
dibromonickel;bis(tris(4-methylphenyl)phosphanium) has a molecular weight of 829.26 g/mol, XLogP of 9.89, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromonickel;bis(tris(4-methylphenyl)phosphanium) is sourced from PubChem (CID 88807192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).