About barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate)
barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) (PubChem CID 88807517) has the molecular formula C8H6BaN4O4S2
and a molecular weight of 423.62 g/mol. Its IUPAC name is barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate).
Molecular Properties
| Compound Name | barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) |
| PubChem CID | 88807517 |
| Molecular Formula | C8H6BaN4O4S2 |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.89 |
| IUPAC Name | barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) |
| SMILES | O=c1cc([O-])[nH]c(=S)[nH]1.O=c1cc([O-])[nH]c(=S)[nH]1.[Ba+2] |
| InChI | InChI=1S/2C4H4N2O2S.Ba/c2*7-2-1-3(8)6-4(9)5-2;/h2*1H,(H3,5,6,7,8,9);/q;;+2/p-2 |
| InChIKey | RECDCNHLJBSWIX-UHFFFAOYSA-L |
| XLogP | -1.37 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate)?
The IUPAC name of barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) (CID 88807517) is barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate).
What is the SMILES notation for barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate)?
The canonical SMILES for barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) is O=c1cc([O-])[nH]c(=S)[nH]1.O=c1cc([O-])[nH]c(=S)[nH]1.[Ba+2].
What is the InChIKey of barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate)?
The InChIKey is RECDCNHLJBSWIX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H4N2O2S.Ba/c2*7-2-1-3(8)6-4(9)5-2;/h2*1H,(H3,5,6,7,8,9);/q;;+2/p-2.
What are the key properties of barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate)?
barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) has a molecular weight of 423.62 g/mol, XLogP of -1.37, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate) is sourced from PubChem (CID 88807517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).