About 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol
2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 88807704) has the molecular formula C16H20N4O4
and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 88807704 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | N#CC(C#N)=C1Nc2ccccc2O1.OCCN(CCO)CCO |
| InChI | InChI=1S/C10H5N3O.C6H15NO3/c11-5-7(6-12)10-13-8-3-1-2-4-9(8)14-10;8-4-1-7(2-5-9)3-6-10/h1-4,13H;8-10H,1-6H2 |
| InChIKey | NRKFIBKVBAUMHD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol (CID 88807704) is 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol is N#CC(C#N)=C1Nc2ccccc2O1.OCCN(CCO)CCO.
What is the InChIKey of 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol?
The InChIKey is NRKFIBKVBAUMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O.C6H15NO3/c11-5-7(6-12)10-13-8-3-1-2-4-9(8)14-10;8-4-1-7(2-5-9)3-6-10/h1-4,13H;8-10H,1-6H2.
What are the key properties of 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol?
2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol has a molecular weight of 332.36 g/mol, XLogP of 0.01, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-1,3-benzoxazol-2-ylidene)propanedinitrile;2-[bis(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 88807704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).