C14H13F17O2S — CID 88807959
1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)butane-1,4-diol (PubChem CID 88807959) has the molecular formula C14H13F17O2S and a molecular weight of 568.29 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)butane-1,4-diol.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)butane-1,4-diol |
|---|---|
| PubChem CID | 88807959 |
| Molecular Formula | C14H13F17O2S |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)butane-1,4-diol |
| SMILES | OCCCC(O)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F17O2S/c15-7(16,3-5-34-6(33)2-1-4-32)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h6,32-33H,1-5H2 |
| InChIKey | FQNDYXMYUNONOP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|