About dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate
dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate (PubChem CID 88808030) has the molecular formula C24H44O7P2S
and a molecular weight of 538.62 g/mol. Its IUPAC name is dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate.
Molecular Properties
| Compound Name | dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate |
| PubChem CID | 88808030 |
| Molecular Formula | C24H44O7P2S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate |
| SMILES | O=P(OSC1CCCCC1)(OC1CCCCC1)OP(=O)(OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C24H44O7P2S/c25-32(27-21-13-5-1-6-14-21,28-22-15-7-2-8-16-22)30-33(26,29-23-17-9-3-10-18-23)31-34-24-19-11-4-12-20-24/h21-24H,1-20H2 |
| InChIKey | RFNNAGOIIRTDPQ-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate?
The IUPAC name of dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate (CID 88808030) is dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate.
What is the SMILES notation for dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate?
The canonical SMILES for dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate is O=P(OSC1CCCCC1)(OC1CCCCC1)OP(=O)(OC1CCCCC1)OC1CCCCC1.
What is the InChIKey of dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate?
The InChIKey is RFNNAGOIIRTDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O7P2S/c25-32(27-21-13-5-1-6-14-21,28-22-15-7-2-8-16-22)30-33(26,29-23-17-9-3-10-18-23)31-34-24-19-11-4-12-20-24/h21-24H,1-20H2.
What are the key properties of dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate?
dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate has a molecular weight of 538.62 g/mol, XLogP of 9.26, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl [cyclohexyloxy(cyclohexylsulfanyloxy)phosphoryl] phosphate is sourced from PubChem (CID 88808030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).