About N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide
N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide (PubChem CID 88808300) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide.
Molecular Properties
| Compound Name | N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide |
| PubChem CID | 88808300 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide |
| SMILES | C=CC/N=C/N(CC=C)CCCCC |
| InChI | InChI=1S/C12H22N2/c1-4-7-8-11-14(10-6-3)12-13-9-5-2/h5-6,12H,2-4,7-11H2,1H3/b13-12+ |
| InChIKey | YDSPPLDZKVUKLI-OUKQBFOZSA-N |
| XLogP | 2.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide?
The IUPAC name of N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide (CID 88808300) is N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide.
What is the SMILES notation for N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide?
The canonical SMILES for N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide is C=CC/N=C/N(CC=C)CCCCC.
What is the InChIKey of N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide?
The InChIKey is YDSPPLDZKVUKLI-OUKQBFOZSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-7-8-11-14(10-6-3)12-13-9-5-2/h5-6,12H,2-4,7-11H2,1H3/b13-12+.
What are the key properties of N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide?
N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide has a molecular weight of 194.32 g/mol, XLogP of 2.88, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentyl-N,N'-bis(prop-2-enyl)methanimidamide is sourced from PubChem (CID 88808300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).