C32H53NO5 — CID 88808800
(8,10-diethyl-3,8,10,11-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 88808800) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is (8,10-diethyl-3,8,10,11-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | (8,10-diethyl-3,8,10,11-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 88808800 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | (8,10-diethyl-3,8,10,11-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCC1(C)CC2(OCC(C)(COC(=O)c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CO2)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C32H53NO5/c1-13-30(11)17-32(21(3)31(12,14-2)33-30)37-19-29(10,20-38-32)18-36-26(35)22-15-23(27(4,5)6)25(34)24(16-22)28(7,8)9/h15-16,21,33-34H,13-14,17-20H2,1-12H3 |
| InChIKey | BSXXHLWDQSGDMU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |