C35H59NO5 — CID 88808858
(2,4,9-triethyl-7,11-dihydroxy-2,4,5-trimethyl-3-azaspiro[5.5]undecan-9-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 88808858) has the molecular formula C35H59NO5 and a molecular weight of 573.86 g/mol. Its IUPAC name is (2,4,9-triethyl-7,11-dihydroxy-2,4,5-trimethyl-3-azaspiro[5.5]undecan-9-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | (2,4,9-triethyl-7,11-dihydroxy-2,4,5-trimethyl-3-azaspiro[5.5]undecan-9-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 88808858 |
| Molecular Formula | C35H59NO5 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.44 |
| IUPAC Name | (2,4,9-triethyl-7,11-dihydroxy-2,4,5-trimethyl-3-azaspiro[5.5]undecan-9-yl)methyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCC1(COC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC(O)C2(CC(C)(CC)NC(C)(CC)C2C)C(O)C1 |
| InChI | InChI=1S/C35H59NO5/c1-13-32(11)20-35(22(4)33(12,14-2)36-32)26(37)18-34(15-3,19-27(35)38)21-41-29(40)23-16-24(30(5,6)7)28(39)25(17-23)31(8,9)10/h16-17,22,26-27,36-39H,13-15,18-21H2,1-12H3 |
| InChIKey | UOMDGRQSOOLQMD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |