C21H31N3O — CID 88808899
(Z,2Z)-2-benzylidene-N-[1-(2-methylpiperazin-1-yl)propoxy]cyclohexan-1-imine (PubChem CID 88808899) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (Z,2Z)-2-benzylidene-N-[1-(2-methylpiperazin-1-yl)propoxy]cyclohexan-1-imine.
| Compound Name | (Z,2Z)-2-benzylidene-N-[1-(2-methylpiperazin-1-yl)propoxy]cyclohexan-1-imine |
|---|---|
| PubChem CID | 88808899 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (Z,2Z)-2-benzylidene-N-[1-(2-methylpiperazin-1-yl)propoxy]cyclohexan-1-imine |
| SMILES | CCC(O/N=C1/CCCC/C1=C/c1ccccc1)N1CCNCC1C |
| InChI | InChI=1S/C21H31N3O/c1-3-21(24-14-13-22-16-17(24)2)25-23-20-12-8-7-11-19(20)15-18-9-5-4-6-10-18/h4-6,9-10,15,17,21-22H,3,7-8,11-14,16H2,1-2H3/b19-15-,23-20- |
| InChIKey | MWVBIOVXBBEVMX-LRLZIJSPSA-N |
| XLogP | 4.05 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|