C20H16BrNO3 — CID 8880895
[(2R)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate (PubChem CID 8880895) has the molecular formula C20H16BrNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is [(2R)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8880895 |
| Molecular Formula | C20H16BrNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | [(2R)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)O[C@H](C)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H16BrNO3/c1-13-3-5-15(6-4-13)11-17(12-22)20(24)25-14(2)19(23)16-7-9-18(21)10-8-16/h3-11,14H,1-2H3/b17-11+/t14-/m1/s1 |
| InChIKey | QGHUCESAQGBMNS-SWEABUAFSA-N |
| XLogP | 4.48 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|