About 1H-isochromeno[4,3-b]pyridine
1H-isochromeno[4,3-b]pyridine (PubChem CID 88809160) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1H-isochromeno[4,3-b]pyridine.
Molecular Properties
| Compound Name | 1H-isochromeno[4,3-b]pyridine |
| PubChem CID | 88809160 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1H-isochromeno[4,3-b]pyridine |
| SMILES | C1=CNC2=c3ccccc3=COC2=C1 |
| InChI | InChI=1S/C12H9NO/c1-2-5-10-9(4-1)8-14-11-6-3-7-13-12(10)11/h1-8,13H |
| InChIKey | LLLRXKJDJRWSFD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-isochromeno[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-isochromeno[4,3-b]pyridine?
The IUPAC name of 1H-isochromeno[4,3-b]pyridine (CID 88809160) is 1H-isochromeno[4,3-b]pyridine.
What is the SMILES notation for 1H-isochromeno[4,3-b]pyridine?
The canonical SMILES for 1H-isochromeno[4,3-b]pyridine is C1=CNC2=c3ccccc3=COC2=C1.
What is the InChIKey of 1H-isochromeno[4,3-b]pyridine?
The InChIKey is LLLRXKJDJRWSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-2-5-10-9(4-1)8-14-11-6-3-7-13-12(10)11/h1-8,13H.
What are the key properties of 1H-isochromeno[4,3-b]pyridine?
1H-isochromeno[4,3-b]pyridine has a molecular weight of 183.21 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-isochromeno[4,3-b]pyridine is sourced from PubChem (CID 88809160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).