C11H14N2O3S — CID 88809250
8,9-dimethoxy-2,4-dimethyl-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide (PubChem CID 88809250) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 8,9-dimethoxy-2,4-dimethyl-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide.
| Compound Name | 8,9-dimethoxy-2,4-dimethyl-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide |
|---|---|
| PubChem CID | 88809250 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 8,9-dimethoxy-2,4-dimethyl-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide |
| SMILES | COc1cc2c(cc1OC)S(C)(=O)=NC(C)=N2 |
| InChI | InChI=1S/C11H14N2O3S/c1-7-12-8-5-9(15-2)10(16-3)6-11(8)17(4,14)13-7/h5-6H,1-4H3 |
| InChIKey | OVWOPBKUYYEYKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |