C15H26N2O — CID 88809357
2,2,6,6-tetramethyl-4-(2-methylbutanoyl)piperidine-1-carbonitrile (PubChem CID 88809357) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(2-methylbutanoyl)piperidine-1-carbonitrile.
| Compound Name | 2,2,6,6-tetramethyl-4-(2-methylbutanoyl)piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 88809357 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(2-methylbutanoyl)piperidine-1-carbonitrile |
| SMILES | CCC(C)C(=O)C1CC(C)(C)N(C#N)C(C)(C)C1 |
| InChI | InChI=1S/C15H26N2O/c1-7-11(2)13(18)12-8-14(3,4)17(10-16)15(5,6)9-12/h11-12H,7-9H2,1-6H3 |
| InChIKey | CJFIUXUMSGHSAD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|