C11H21N3 — CID 88809463
(1,2,2,6,6-pentamethylpiperidin-4-yl)cyanamide (PubChem CID 88809463) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl)cyanamide.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl)cyanamide |
|---|---|
| PubChem CID | 88809463 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl)cyanamide |
| SMILES | CN1C(C)(C)CC(NC#N)CC1(C)C |
| InChI | InChI=1S/C11H21N3/c1-10(2)6-9(13-8-12)7-11(3,4)14(10)5/h9,13H,6-7H2,1-5H3 |
| InChIKey | RGYNVJCVUQGLAM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|