About hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite
hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite (PubChem CID 88810490) has the molecular formula C20H22O4S
and a molecular weight of 358.46 g/mol. Its IUPAC name is hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite.
Molecular Properties
| Compound Name | hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite |
| PubChem CID | 88810490 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite |
| SMILES | CCC#CCCOS(=O)OCCOc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H22O4S/c1-2-3-4-10-15-23-25(21)24-17-16-22-20-14-9-8-13-19(20)18-11-6-5-7-12-18/h5-9,11-14H,2,10,15-17H2,1H3 |
| InChIKey | JIOFVFZTIPCKJT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite?
The IUPAC name of hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite (CID 88810490) is hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite.
What is the SMILES notation for hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite?
The canonical SMILES for hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite is CCC#CCCOS(=O)OCCOc1ccccc1-c1ccccc1.
What is the InChIKey of hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite?
The InChIKey is JIOFVFZTIPCKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O4S/c1-2-3-4-10-15-23-25(21)24-17-16-22-20-14-9-8-13-19(20)18-11-6-5-7-12-18/h5-9,11-14H,2,10,15-17H2,1H3.
What are the key properties of hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite?
hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite has a molecular weight of 358.46 g/mol, XLogP of 4.15, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-ynyl 2-(2-phenylphenoxy)ethyl sulfite is sourced from PubChem (CID 88810490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).