About acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid
acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid (PubChem CID 88810530) has the molecular formula C18H22N2O8S
and a molecular weight of 426.45 g/mol. Its IUPAC name is acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid.
Molecular Properties
| Compound Name | acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid |
| PubChem CID | 88810530 |
| Molecular Formula | C18H22N2O8S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid |
| SMILES | CC(=O)OC(C)=O.CC(=O)n1c(=O)n(C(C)=O)c2c(CCCCC(=O)O)scc21 |
| InChI | InChI=1S/C14H16N2O5S.C4H6O3/c1-8(17)15-10-7-22-11(5-3-4-6-12(19)20)13(10)16(9(2)18)14(15)21;1-3(5)7-4(2)6/h7H,3-6H2,1-2H3,(H,19,20);1-2H3 |
| InChIKey | FAYYZFQLZAXHTD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid?
The IUPAC name of acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid (CID 88810530) is acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid.
What is the SMILES notation for acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid?
The canonical SMILES for acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid is CC(=O)OC(C)=O.CC(=O)n1c(=O)n(C(C)=O)c2c(CCCCC(=O)O)scc21.
What is the InChIKey of acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid?
The InChIKey is FAYYZFQLZAXHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5S.C4H6O3/c1-8(17)15-10-7-22-11(5-3-4-6-12(19)20)13(10)16(9(2)18)14(15)21;1-3(5)7-4(2)6/h7H,3-6H2,1-2H3,(H,19,20);1-2H3.
What are the key properties of acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid?
acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid has a molecular weight of 426.45 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoic acid is sourced from PubChem (CID 88810530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).