C17H16N4O — CID 888108
3,3-diphenyl-N-(1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 888108) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3,3-diphenyl-N-(1H-1,2,4-triazol-5-yl)propanamide.
| Compound Name | 3,3-diphenyl-N-(1H-1,2,4-triazol-5-yl)propanamide |
|---|---|
| PubChem CID | 888108 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3,3-diphenyl-N-(1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C17H16N4O/c22-16(20-17-18-12-19-21-17)11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H2,18,19,20,21,22) |
| InChIKey | IOOWKAPRRVOIFL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |