C16H20ClN3O — CID 88810973
4-(2,4-diamino-3,5-dimethylphenyl)imino-2,6-dimethylcyclohexa-2,5-dien-1-one;hydrochloride (PubChem CID 88810973) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-(2,4-diamino-3,5-dimethylphenyl)imino-2,6-dimethylcyclohexa-2,5-dien-1-one;hydrochloride.
| Compound Name | 4-(2,4-diamino-3,5-dimethylphenyl)imino-2,6-dimethylcyclohexa-2,5-dien-1-one;hydrochloride |
|---|---|
| PubChem CID | 88810973 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-(2,4-diamino-3,5-dimethylphenyl)imino-2,6-dimethylcyclohexa-2,5-dien-1-one;hydrochloride |
| SMILES | CC1=CC(=Nc2cc(C)c(N)c(C)c2N)C=C(C)C1=O.Cl |
| InChI | InChI=1S/C16H19N3O.ClH/c1-8-7-13(15(18)11(4)14(8)17)19-12-5-9(2)16(20)10(3)6-12;/h5-7H,17-18H2,1-4H3;1H |
| InChIKey | QNVWJROVVVNPDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|