C12H13NO — CID 88811466
4-buta-1,3-dienyl-8-hydroxyocta-2,4,6-trienenitrile (PubChem CID 88811466) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-buta-1,3-dienyl-8-hydroxyocta-2,4,6-trienenitrile.
| Compound Name | 4-buta-1,3-dienyl-8-hydroxyocta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 88811466 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-buta-1,3-dienyl-8-hydroxyocta-2,4,6-trienenitrile |
| SMILES | C=CC=CC(C=CC#N)=CC=CCO |
| InChI | InChI=1S/C12H13NO/c1-2-3-7-12(9-6-10-13)8-4-5-11-14/h2-9,14H,1,11H2 |
| InChIKey | JADGXABISKOFHV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|