C6H5NO4S2 — CID 88811604
4,6-dioxo-3a,6a-dihydro-[1,3]dithiolo[4,5-c]pyrrole-5-carboxylic acid (PubChem CID 88811604) has the molecular formula C6H5NO4S2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4,6-dioxo-3a,6a-dihydro-[1,3]dithiolo[4,5-c]pyrrole-5-carboxylic acid.
| Compound Name | 4,6-dioxo-3a,6a-dihydro-[1,3]dithiolo[4,5-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 88811604 |
| Molecular Formula | C6H5NO4S2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | 4,6-dioxo-3a,6a-dihydro-[1,3]dithiolo[4,5-c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)N1C(=O)C2SCSC2C1=O |
| InChI | InChI=1S/C6H5NO4S2/c8-4-2-3(13-1-12-2)5(9)7(4)6(10)11/h2-3H,1H2,(H,10,11) |
| InChIKey | VJNWQYOQFJFNJD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|