C48H36Cl8O4Si4 — CID 88811876
2-(1,2,3,4,5,5,6,6-octachlorocyclohex-2-en-1-yl)-2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 88811876) has the molecular formula C48H36Cl8O4Si4 and a molecular weight of 1072.78 g/mol. Its IUPAC name is 2-(1,2,3,4,5,5,6,6-octachlorocyclohex-2-en-1-yl)-2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(1,2,3,4,5,5,6,6-octachlorocyclohex-2-en-1-yl)-2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 88811876 |
| Molecular Formula | C48H36Cl8O4Si4 |
| Molecular Weight | 1072.78 g/mol |
| Exact Mass | 1067.92 |
| IUPAC Name | 2-(1,2,3,4,5,5,6,6-octachlorocyclohex-2-en-1-yl)-2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | ClC1=C(Cl)C(Cl)([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)C(Cl)(Cl)C(Cl)(Cl)C1Cl |
| InChI | InChI=1S/C48H36Cl8O4Si4/c49-43-44(50)46(52,53)48(55,56)47(54,45(43)51)64(42-34-20-7-21-35-42)59-62(38-26-12-3-13-27-38,39-28-14-4-15-29-39)57-61(36-22-8-1-9-23-36,37-24-10-2-11-25-37)58-63(60-64,40-30-16-5-17-31-40)41-32-18-6-19-33-41/h1-35,44H |
| InChIKey | MPTWSTCJGGHHHN-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.78 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|