About azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate
azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate (PubChem CID 88812164) has the molecular formula C12H11BF4N2O2S
and a molecular weight of 334.10 g/mol. Its IUPAC name is azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate.
Molecular Properties
| Compound Name | azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate |
| PubChem CID | 88812164 |
| Molecular Formula | C12H11BF4N2O2S |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[NH+].O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S.BF4.N2/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3,4)5;1-2/h1-10H;;/q;-1;/p+1 |
| InChIKey | ABDIVPSHFJLQKC-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate?
The IUPAC name of azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate (CID 88812164) is azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate.
What is the SMILES notation for azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate?
The canonical SMILES for azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate is F[B-](F)(F)F.N#[NH+].O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate?
The InChIKey is ABDIVPSHFJLQKC-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10O2S.BF4.N2/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3,4)5;1-2/h1-10H;;/q;-1;/p+1.
What are the key properties of azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate?
azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate has a molecular weight of 334.10 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;benzenesulfonylbenzene;tetrafluoroborate is sourced from PubChem (CID 88812164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).